cas: 84000-12-4 — see every product listed under this CAS number, including other names
Fmoc-N-Me-L-Met-OH, 98% (CAS 84000-12-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11G68S-100mg |
| cas | 84000-12-4 |
| size | 100mg |
| availability | 149.44g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1614.80 Pln | |
| Chemat | 50g | 2853.20 Pln | |
| Chemat | 100g | 5027.60 Pln | |
| Fluorochem | 250mg | 117.68 Pln | |
| Fluorochem | 1g | 180.16 Pln | |
| Fluorochem | 5g | 648.75 Pln | |
| Fluorochem | 10g | 1231.88 Pln | |
| Fluorochem | 25g | 2887.54 Pln | |
| Fluorochem | 100g | 8796.92 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylsulfanylbutanoic acid (CAS 84000-12-4) is a chemical compound with the molecular formula C21H23NO4S and a molecular weight of 385.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylsulfanylbutanoic acid. InChIKey: SPYUJXKMEJUAOI-IBGZPJMESA-N.
| Molecular formula | C21H23NO4S |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylsulfanylbutanoic acid |
| InChIKey | SPYUJXKMEJUAOI-IBGZPJMESA-N |
| SMILES | CN([C@@H](CCSC)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)