cas: 130309-37-4 — see every product listed under this CAS number, including other names
Fmoc-Oic-OH, 98%, 98% (CAS 130309-37-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111U09-100mg |
| cas | 130309-37-4 |
| size | 100mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 232.40 Pln | |
| Chemat | 100g | 683.60 Pln | |
| Chemat | 250g | 1442.00 Pln | |
| Chemat | 500g | 2404.80 Pln | |
| Chemat | 50g | 390.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,3aS,7aS)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (CAS 130309-37-4) is a chemical compound with the molecular formula C24H25NO4 and a molecular weight of 391.5 g/mol. IUPAC name: (2S,3aS,7aS)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid. InChIKey: JBZXLQHJZHITMW-RXYZOABWSA-N.
| Molecular formula | C24H25NO4 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | (2S,3aS,7aS)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| InChIKey | JBZXLQHJZHITMW-RXYZOABWSA-N |
| SMILES | C1CC[C@H]2[C@@H](C1)C[C@H](N2C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)