CAS 1013997-35-7 is the registry number for (2S)-2-[(tert-Butoxy)carbonylamino]-3-(4-naphthylphenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-naphthalen-1-ylphenyl)propanoic acid (CAS 1013997-35-7) is a chemical compound with the molecular formula C24H25NO4 and a molecular weight of 391.5 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-naphthalen-1-ylphenyl)propanoic acid. InChIKey: FFMFZQISJICJAI-NRFANRHFSA-N.
| Molecular formula | C24H25NO4 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-naphthalen-1-ylphenyl)propanoic acid |
| InChIKey | FFMFZQISJICJAI-NRFANRHFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)C2=CC=CC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)