Products 2548969-38-4
CAS 2548969-38-4 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,3-dicyclopropylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3,3-dicyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2548969-38-4) is a chemical compound with the molecular formula C24H25NO4 and a molecular weight of 391.5 g/mol. IUPAC name: (2S)-3,3-dicyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NQUNXRKHEVMSBN-QFIPXVFZSA-N.
| Molecular formula | C24H25NO4 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | (2S)-3,3-dicyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NQUNXRKHEVMSBN-QFIPXVFZSA-N |
| SMILES | C1CC1C(C2CC2)[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)