Products 224169-27-1
CAS 224169-27-1 appears in our catalog under these names: GLN–1062, GLN-1062/ 99.12% (existing batch purity), GLN-1062, Benzgalantamine, Benzgalantamine, 99.51%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 20mg.
[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] benzoate (CAS 224169-27-1) is a chemical compound with the molecular formula C24H25NO4 and a molecular weight of 391.5 g/mol. IUPAC name: [(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] benzoate. InChIKey: JKVNJTYHRABHIY-WXVUKLJWSA-N.
| Molecular formula | C24H25NO4 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | [(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] benzoate |
| InChIKey | JKVNJTYHRABHIY-WXVUKLJWSA-N |
| SMILES | CN1CC[C@@]23C=C[C@@H](C[C@@H]2OC4=C(C=CC(=C34)C1)OC)OC(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)