CAS 130309-37-4 appears in our catalog under these names: Fmoc–Oic–OH, Fmoc-Oic-OH (2S,3aS,7aS), (2S,3aS,7aS)-1-Fmoc-octahydroindole-2-carboxylic acid, 98% , Fmoc-L-octahydroindole-2-carboxylic acid, Fmoc-Oic-OH 98%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 5g, 2g, 10g, 50g, 25g, 100mg.
(2S,3aS,7aS)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (CAS 130309-37-4) is a chemical compound with the molecular formula C24H25NO4 and a molecular weight of 391.5 g/mol. IUPAC name: (2S,3aS,7aS)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid. InChIKey: JBZXLQHJZHITMW-RXYZOABWSA-N.
| Molecular formula | C24H25NO4 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | (2S,3aS,7aS)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| InChIKey | JBZXLQHJZHITMW-RXYZOABWSA-N |
| SMILES | C1CC[C@H]2[C@@H](C1)C[C@H](N2C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)