cas: 35661-40-6 — see every product listed under this CAS number, including other names
Fmoc-Phe-OH, 98% (CAS 35661-40-6) is a chemical reagent available from Chemat. Available pack sizes: 250g, 100g, 50g, 25g, 1g, 10g, 500g, 1kg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11I83V-250g |
| cas | 35661-40-6 |
| size | 250g |
| availability | 50000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 275.60 Pln | |
| Chemat | 100g | 146.00 Pln | |
| Chemat | 50g | 107.60 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 10g | 159.34 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 273.88 Pln | |
| Fluorochem | 250g | 555.03 Pln | |
| Fluorochem | 500g | 888.25 Pln | |
| Fluorochem | 1kg | 2221.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid (CAS 35661-40-6) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid. InChIKey: SJVFAHZPLIXNDH-QFIPXVFZSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid |
| InChIKey | SJVFAHZPLIXNDH-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)