cas: 478183-58-3 — see every product listed under this CAS number, including other names
Fmoc-Tyr(3-Cl)-OH, 95% (CAS 478183-58-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A357911-250mg |
| cas | 478183-58-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 431.56 Pln | |
| Ambeed | 25g | 1644.19 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 458.75 Pln | |
| BLDpharm | 25g | 1769.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 478183-58-3) is a chemical compound with the molecular formula C24H20ClNO5 and a molecular weight of 437.9 g/mol. IUPAC name: (2S)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: KHDGYTHHDSEGNQ-NRFANRHFSA-N.
| Molecular formula | C24H20ClNO5 |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | (2S)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | KHDGYTHHDSEGNQ-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=C(C=C4)O)Cl)C(=O)O |
Computed by PubChem (NCBI)