cas: 478183-58-3 — see every product listed under this CAS number, including other names
Fmoc-Tyr(3-Cl)-OH, 97%, 97% (CAS 478183-58-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DD2I-100mg |
| cas | 478183-58-3 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 10g | 635.60 Pln | |
| Chemat | 25g | 1370.00 Pln | |
| Chemat | 100g | 4254.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 478183-58-3) is a chemical compound with the molecular formula C24H20ClNO5 and a molecular weight of 437.9 g/mol. IUPAC name: (2S)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: KHDGYTHHDSEGNQ-NRFANRHFSA-N.
| Molecular formula | C24H20ClNO5 |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | (2S)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | KHDGYTHHDSEGNQ-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=C(C=C4)O)Cl)C(=O)O |
Computed by PubChem (NCBI)