CAS 918329-78-9 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-acetoxyphenyl)propanoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 10g, 25g.
(2S)-3-(4-acetyloxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 918329-78-9) is a chemical compound with the molecular formula C26H23NO6 and a molecular weight of 445.5 g/mol. IUPAC name: (2S)-3-(4-acetyloxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: DGYAMPGGERPSOR-DEOSSOPVSA-N.
| Molecular formula | C26H23NO6 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (2S)-3-(4-acetyloxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | DGYAMPGGERPSOR-DEOSSOPVSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)