CAS 150009-58-8 appears in our catalog under these names: Fmoc-d-asp(obzl)-oh, 95%, Fmoc–D–Asp(OBzl)–OH, Fmoc-D-Asp(OBzl)-OH 98%, Fmoc-D-Asp(OBzl)-OH, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 100g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-phenylmethoxybutanoic acid (CAS 150009-58-8) is a chemical compound with the molecular formula C26H23NO6 and a molecular weight of 445.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-phenylmethoxybutanoic acid. InChIKey: OQGAELAJEGGNKG-HSZRJFAPSA-N.
| Molecular formula | C26H23NO6 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-phenylmethoxybutanoic acid |
| InChIKey | OQGAELAJEGGNKG-HSZRJFAPSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)