CAS 1932027-25-2 appears in our catalog under these names: Fmoc-D-Asp-obzl, 95%, (3R)-4-(benzyloxy)-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-oxobutanoic acid, ≥98%, ≥98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 5g, 25g, 100g.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-phenylmethoxybutanoic acid (CAS 1932027-25-2) is a chemical compound with the molecular formula C26H23NO6 and a molecular weight of 445.5 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-phenylmethoxybutanoic acid. InChIKey: CBZSVHFNEMONDZ-HSZRJFAPSA-N.
| Molecular formula | C26H23NO6 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-phenylmethoxybutanoic acid |
| InChIKey | CBZSVHFNEMONDZ-HSZRJFAPSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)