Products 1998647-06-5
CAS 1998647-06-5 is the registry number for Fmoc-L-Dhbd-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 50mg, 250mg.
(2S)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1998647-06-5) is a chemical compound with the molecular formula C26H23NO6 and a molecular weight of 445.5 g/mol. IUPAC name: (2S)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: CGUKISWRWVBUCJ-QFIPXVFZSA-N.
| Molecular formula | C26H23NO6 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (2S)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | CGUKISWRWVBUCJ-QFIPXVFZSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)