CAS 125760-26-1 appears in our catalog under these names: Fmoc-Ser-OPAC, 97%, Fmoc–Ser–OPAC. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100g, 25g.
Phenacyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoate (CAS 125760-26-1) is a chemical compound with the molecular formula C26H23NO6 and a molecular weight of 445.5 g/mol. IUPAC name: phenacyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoate. InChIKey: PYOVUIPZMRWLQC-QHCPKHFHSA-N.
| Molecular formula | C26H23NO6 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | phenacyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoate |
| InChIKey | PYOVUIPZMRWLQC-QHCPKHFHSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)COC(=O)[C@H](CO)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)