cas: 71989-40-7 — see every product listed under this CAS number, including other names
Fmoc-Tyr(Bzl)-OH, 98% (CAS 71989-40-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A153606-1g |
| cas | 71989-40-7 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 348.12 Pln | |
| Ambeed | 100g | 1182.50 Pln | |
| Ambeed | 500g | 3958.19 Pln | |
| BLDpharm | 1g | 142.20 Pln | |
| BLDpharm | 5g | 158.86 Pln | |
| BLDpharm | 10g | 186.63 Pln | |
| BLDpharm | 25g | 342.13 Pln | |
| BLDpharm | 100g | 1158.51 Pln | |
| BLDpharm | 500g | 3885.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 71989-40-7) is a chemical compound with the molecular formula C31H27NO5 and a molecular weight of 493.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: REHSJSKPWIOKIJ-LJAQVGFWSA-N.
| Molecular formula | C31H27NO5 |
|---|---|
| Molecular weight | 493.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | REHSJSKPWIOKIJ-LJAQVGFWSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)