cas: 71989-40-7 — see every product listed under this CAS number, including other names
Fmoc-Tyr(Bzl)-OH, 97% (CAS 71989-40-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | M03430-1G |
| cas | 71989-40-7 |
| size | 1g |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 50g | 513.38 Pln | |
| Fluorochem | 100g | 898.66 Pln | |
| Fluorochem | 500g | 4048.59 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 100g | 530.00 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 71989-40-7) is a chemical compound with the molecular formula C31H27NO5 and a molecular weight of 493.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: REHSJSKPWIOKIJ-LJAQVGFWSA-N.
| Molecular formula | C31H27NO5 |
|---|---|
| Molecular weight | 493.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | REHSJSKPWIOKIJ-LJAQVGFWSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)