cas: 1219422-04-4 — see every product listed under this CAS number, including other names
Fmoc-beta-cyclopentyl-DL-alanine, 98%, 98% (CAS 1219422-04-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch129KAR-50mg |
| cas | 1219422-04-4 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 453.20 Pln | |
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1219422-04-4) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: 3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NVZVRXJTMCMDNR-UHFFFAOYSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NVZVRXJTMCMDNR-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)