cas: 198561-07-8 — see every product listed under this CAS number, including other names
Fmoc-propargyl-Gly-OH , 98.00% (CAS 198561-07-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM43910M-1g |
| cas | 198561-07-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 863.41 Pln | |
| Chemat | 250mg | 364.12 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid (CAS 198561-07-8) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid. InChIKey: DJGMNCKHNMRKFM-SFHVURJKSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid |
| InChIKey | DJGMNCKHNMRKFM-SFHVURJKSA-N |
| SMILES | C#CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)