cas: 381241-08-3 — see every product listed under this CAS number, including other names
Fmoc-trans-2-aminocyclohexanecarboxylic acid (CAS 381241-08-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493550-50MG |
| cas | 381241-08-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 612.30 Pln | |
| Fluorochem | 250mg | 1799.38 Pln | |
| Fluorochem | 1g | 3939.26 Pln |
| delivery time | 3-4 weeks |
|---|
Trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 381241-08-3) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: NZMNDTGOODAUNI-UYAOXDASSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | NZMNDTGOODAUNI-UYAOXDASSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)