CAS 147900-45-6 appears in our catalog under these names: Fmoc-1,4-cis-achc-oh, 97%, Fmoc-1,4-cis-ACHC-OH, Fmoc-cis-4-aminocyclohexane carboxylic acid, Fmoc-cis-1,4-Achc-OH 97%, cis-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)cyclohexanecarboxylic acid, 97%, 97%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 25g, 2g, 10g, 100mg.
4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 147900-45-6) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: RIZQTCLNVHZQOO-UHFFFAOYSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | RIZQTCLNVHZQOO-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)