CAS 19368-18-4 appears in our catalog under these names: Ftaxilide/ 99.78% (existing batch purity), Ftaxilide, Ftaxilide 99%, 2-(2,6-Dimethylphenylcarbamoyl)benzoic acid, 99%, 99%, Ftaxilide, 99.17%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso), 1mg.
2-[(2,6-dimethylphenyl)carbamoyl]benzoic acid (CAS 19368-18-4) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 2-[(2,6-dimethylphenyl)carbamoyl]benzoic acid. InChIKey: LLECMGGNFBKPRH-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 2-[(2,6-dimethylphenyl)carbamoyl]benzoic acid |
| InChIKey | LLECMGGNFBKPRH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)