cas: 24461-32-3 — see every product listed under this CAS number, including other names
Fumaric acid-d2, 99.00% (CAS 24461-32-3) is a chemical reagent available from Chemat. Available pack sizes: 5 mg, 10 mg, 25 mg, 100 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W015883S3-5 mg |
| cas | 24461-32-3 |
| size | 5 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 mg | 263.96 Pln | |
| MedChemExpress | 10 mg | 361.49 Pln | |
| MedChemExpress | 25 mg | 598.33 Pln | |
| MedChemExpress | 100 mg | 1341.37 Pln | |
| MedChemExpress | 50 mg | 886.26 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.00% |
(E)-2,3-dideuteriobut-2-enedioic acid (CAS 24461-32-3) is a chemical compound with the molecular formula C4H4O4 and a molecular weight of 118.08 g/mol. IUPAC name: (E)-2,3-dideuteriobut-2-enedioic acid. InChIKey: VZCYOOQTPOCHFL-FBBQFRKLSA-N.
| Molecular formula | C4H4O4 |
|---|---|
| Molecular weight | 118.08 g/mol |
| IUPAC name | (E)-2,3-dideuteriobut-2-enedioic acid |
| InChIKey | VZCYOOQTPOCHFL-FBBQFRKLSA-N |
| SMILES | [2H]/C(=C(/[2H])\C(=O)O)/C(=O)O |
Computed by PubChem (NCBI)