Products 100858-52-4
CAS 100858-52-4 is the registry number for Fumaric acid-13C2,d2, 98.00%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
(E)-2,3-dideuterio(1,4-13C2)but-2-enedioic acid (CAS 100858-52-4) is a chemical compound with the molecular formula C4H4O4 and a molecular weight of 120.07 g/mol. IUPAC name: (E)-2,3-dideuterio(1,4-13C2)but-2-enedioic acid. InChIKey: VZCYOOQTPOCHFL-WSHNTRCTSA-N.
| Molecular formula | C4H4O4 |
|---|---|
| Molecular weight | 120.07 g/mol |
| IUPAC name | (E)-2,3-dideuterio(1,4-13C2)but-2-enedioic acid |
| InChIKey | VZCYOOQTPOCHFL-WSHNTRCTSA-N |
| SMILES | [2H]/C(=C(/[2H])\[13C](=O)O)/[13C](=O)O |
Computed by PubChem (NCBI)