Products 194160-45-7
CAS 194160-45-7 appears in our catalog under these names: Fumaric acid-d4, Fumaric acid-d4, 98%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 250mg, 500mg, 50 mg, 10 mg, 100 mg, 25 mg, 5 mg.
Dideuterio (E)-2,3-dideuteriobut-2-enedioate (CAS 194160-45-7) is a chemical compound with the molecular formula C4H4O4 and a molecular weight of 120.10 g/mol. IUPAC name: dideuterio (E)-2,3-dideuteriobut-2-enedioate. InChIKey: VZCYOOQTPOCHFL-JXRVJRKUSA-N.
| Molecular formula | C4H4O4 |
|---|---|
| Molecular weight | 120.10 g/mol |
| IUPAC name | dideuterio (E)-2,3-dideuteriobut-2-enedioate |
| InChIKey | VZCYOOQTPOCHFL-JXRVJRKUSA-N |
| SMILES | [2H]/C(=C(/[2H])\C(=O)O[2H])/C(=O)O[2H] |
Computed by PubChem (NCBI)