CAS 24461-32-3 appears in our catalog under these names: Fumaric Acid-d2, Fumaric Acid-d2, >95% (HPLC), Fumaric-2,3-d2 Acid, 98 atom % D, min 98% Chemical Purity, fumaric–D2 acid, FUMARIC-D2 ACID, 98 ATOM % D. Offered by: Chemat Brand, TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 100mg, 1g, 0,25g, 10mg, 25mg, 5G, 1x10mg.
(E)-2,3-dideuteriobut-2-enedioic acid (CAS 24461-32-3) is a chemical compound with the molecular formula C4H4O4 and a molecular weight of 118.08 g/mol. IUPAC name: (E)-2,3-dideuteriobut-2-enedioic acid. InChIKey: VZCYOOQTPOCHFL-FBBQFRKLSA-N.
| Molecular formula | C4H4O4 |
|---|---|
| Molecular weight | 118.08 g/mol |
| IUPAC name | (E)-2,3-dideuteriobut-2-enedioic acid |
| InChIKey | VZCYOOQTPOCHFL-FBBQFRKLSA-N |
| SMILES | [2H]/C(=C(/[2H])\C(=O)O)/C(=O)O |
Computed by PubChem (NCBI)