Products 96503-56-9
CAS 96503-56-9 is the registry number for Fumaric acid-13C2, 99.9%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
(E)-(1,4-13C2)but-2-enedioic acid (CAS 96503-56-9) is a chemical compound with the molecular formula C4H4O4 and a molecular weight of 118.06 g/mol. IUPAC name: (E)-(1,4-13C2)but-2-enedioic acid. InChIKey: VZCYOOQTPOCHFL-ZWWDXPBASA-N.
| Molecular formula | C4H4O4 |
|---|---|
| Molecular weight | 118.06 g/mol |
| IUPAC name | (E)-(1,4-13C2)but-2-enedioic acid |
| InChIKey | VZCYOOQTPOCHFL-ZWWDXPBASA-N |
| SMILES | C(=C/[13C](=O)O)\[13C](=O)O |
Computed by PubChem (NCBI)