Products 95463-56-2
CAS 95463-56-2 appears in our catalog under these names: GR-95168/ 99.73% (existing batch purity), (+)-C-BVDU. Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
5-[(E)-2-bromoethenyl]-1-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione (CAS 95463-56-2) is a chemical compound with the molecular formula C12H15BrN2O4 and a molecular weight of 331.16 g/mol. IUPAC name: 5-[(E)-2-bromoethenyl]-1-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione. InChIKey: KAVDAMFOTJIBCK-CTNBOOGPSA-N.
| Molecular formula | C12H15BrN2O4 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | 5-[(E)-2-bromoethenyl]-1-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione |
| InChIKey | KAVDAMFOTJIBCK-CTNBOOGPSA-N |
| SMILES | C1[C@H](C[C@@H]([C@H]1CO)O)N2C=C(C(=O)NC2=O)/C=C/Br |
Computed by PubChem (NCBI)
Synonyms:
(+)-C-BVDU, orb1741425