cas: 86361-55-9 — see every product listed under this CAS number, including other names
Gnetol 95% (CAS 86361-55-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A449058-10mg |
| cas | 86361-55-9 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 414.88 Pln | |
| Ambeed | 25mg | 748.62 Pln | |
| Ambeed | 50mg | 948.88 Pln | |
| Ambeed | 100mg | 1560.75 Pln | |
| Ambeed | 250mg | 2606.50 Pln | |
| Ambeed | 1g | 6917.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A449058 |
2-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,3-diol (CAS 86361-55-9) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 2-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,3-diol. InChIKey: DQULNTWGBBNZSC-SNAWJCMRSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 2-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,3-diol |
| InChIKey | DQULNTWGBBNZSC-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)O)/C=C/C2=CC(=CC(=C2)O)O)O |
Computed by PubChem (NCBI)