Guanine, 99.50%
cas: 73-40-5 — see every product listed under this CAS number, including other names
Guanine, 99.50% (CAS 73-40-5) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 50 g, 500 mg, 5 g, 100 mg, 1 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-Y1055-100 g |
| cas | 73-40-5 |
| size | 100 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 1011.65 Pln | |
| MedChemExpress | 50 g | 863.04 Pln | |
| MedChemExpress | 500 mg | 310.40 Pln | |
| MedChemExpress | 5 g | 505.45 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 361.49 Pln | |
| MedChemExpress | 10 g | 579.76 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.50% |
Guanine is a 2-aminopurine carrying a 6-oxo substituent. It has a role as a mouse metabolite, a Saccharomyces cerevisiae metabolite, an Escherichia coli metabolite, a human metabolite and an algal metabolite. It is a member of 2-aminopurines, an oxopurine and a purine nucleobase. It derives from a hydride of a 9H-purine.
Source: ChEBI
| Molecular formula | C5H5N5O |
|---|---|
| Molecular weight | 151.13 g/mol |
| IUPAC name | 2-amino-1,7-dihydropurin-6-one |
| InChIKey | UYTPUPDQBNUYGX-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)