Products 202407-12-3
CAS 202407-12-3 is the registry number for Guanine-13C,15N2, 98.6%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
2-amino-1,7-dihydropurin-6-one (CAS 202407-12-3) is a chemical compound with the molecular formula C5H5N5O and a molecular weight of 154.11 g/mol. IUPAC name: 2-amino-1,7-dihydropurin-6-one. InChIKey: UYTPUPDQBNUYGX-QWRHZHGESA-N.
| Molecular formula | C5H5N5O |
|---|---|
| Molecular weight | 154.11 g/mol |
| IUPAC name | 2-amino-1,7-dihydropurin-6-one |
| InChIKey | UYTPUPDQBNUYGX-QWRHZHGESA-N |
| SMILES | [13CH]1=[15N]C2=C([15NH]1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)