CAS 1207522-89-1 is the registry number for Guanine-13C5,15N5. Offered by: TRC. Available pack sizes: 25mg.
2-(15N)azanyl-1,7-dihydropurin-6-one (CAS 1207522-89-1) is a chemical compound with the molecular formula C5H5N5O and a molecular weight of 161.057 g/mol. IUPAC name: 2-(15N)azanyl-1,7-dihydropurin-6-one. InChIKey: UYTPUPDQBNUYGX-IIYFYTTLSA-N.
| Molecular formula | C5H5N5O |
|---|---|
| Molecular weight | 161.057 g/mol |
| IUPAC name | 2-(15N)azanyl-1,7-dihydropurin-6-one |
| InChIKey | UYTPUPDQBNUYGX-IIYFYTTLSA-N |
| SMILES | [13CH]1=[15N][13C]2=[13C]([15NH]1)[13C](=O)[15NH][13C](=[15N]2)[15NH2] |
Computed by PubChem (NCBI)