CAS 168566-53-8 appears in our catalog under these names: Guanine-15N5, Guanine–15N5. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 1mg, 5mg.
2-(15N)azanyl-1,7-dihydropurin-6-one (CAS 168566-53-8) is a chemical compound with the molecular formula C5H5N5O and a molecular weight of 156.09 g/mol. IUPAC name: 2-(15N)azanyl-1,7-dihydropurin-6-one. InChIKey: UYTPUPDQBNUYGX-CIKZIQIKSA-N.
| Molecular formula | C5H5N5O |
|---|---|
| Molecular weight | 156.09 g/mol |
| IUPAC name | 2-(15N)azanyl-1,7-dihydropurin-6-one |
| InChIKey | UYTPUPDQBNUYGX-CIKZIQIKSA-N |
| SMILES | C1=[15N]C2=C([15NH]1)C(=O)[15NH]C(=[15N]2)[15NH2] |
Computed by PubChem (NCBI)