Products 201489-20-5
CAS 201489-20-5 is the registry number for Guanine-13C, 99.5%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg.
2-amino-1,7-dihydropurin-6-one (CAS 201489-20-5) is a chemical compound with the molecular formula C5H5N5O and a molecular weight of 152.12 g/mol. IUPAC name: 2-amino-1,7-dihydropurin-6-one. InChIKey: UYTPUPDQBNUYGX-OUBTZVSYSA-N.
| Molecular formula | C5H5N5O |
|---|---|
| Molecular weight | 152.12 g/mol |
| IUPAC name | 2-amino-1,7-dihydropurin-6-one |
| InChIKey | UYTPUPDQBNUYGX-OUBTZVSYSA-N |
| SMILES | [13CH]1=NC2=C(N1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)