cas: 201353-89-1 — see every product listed under this CAS number, including other names
H–allo–Thr(tBu)–OH (CAS 201353-89-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 500mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GA22045-1000 |
| cas | 201353-89-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 1135.30 Pln | |
| GLPBio | 250mg | 948.08 Pln | |
| GLPBio | 500mg | 1013.60 Pln | |
| GLPBio | 5g | 2099.48 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 201353-89-1) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: (2S,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: NMJINEMBBQVPGY-WDSKDSINSA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid |
| InChIKey | NMJINEMBBQVPGY-WDSKDSINSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)N)OC(C)(C)C |
Computed by PubChem (NCBI)