cas: 201353-89-1 — see every product listed under this CAS number, including other names
H-allo-Thr(tBu)-OH, 97.0% (CAS 201353-89-1) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W051351-5 g |
| cas | 201353-89-1 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1763.98 Pln | |
| MedChemExpress | 1 g | 454.37 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
(2S,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 201353-89-1) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: (2S,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: NMJINEMBBQVPGY-WDSKDSINSA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid |
| InChIKey | NMJINEMBBQVPGY-WDSKDSINSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)N)OC(C)(C)C |
Computed by PubChem (NCBI)