CAS 275826-36-3 appears in our catalog under these names: (S)-3-Amino-3-(4-bromophenyl)propanoic acid, 98%, (S)-3-Amino-3-(4-bromophenyl)propionic acid, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg, 10g, 50g.
(3S)-3-amino-3-(4-bromophenyl)propanoic acid (CAS 275826-36-3) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: (3S)-3-amino-3-(4-bromophenyl)propanoic acid. InChIKey: RBOUYDUXPMAYMJ-QMMMGPOBSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-bromophenyl)propanoic acid |
| InChIKey | RBOUYDUXPMAYMJ-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)Br |
Computed by PubChem (NCBI)