cas: 3303-34-2 — see every product listed under this CAS number, including other names
H-Ala-Leu-OH, 98%, 98% (CAS 3303-34-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg, 250mg, 1g, 5g, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114R8A-10mg |
| cas | 3303-34-2 |
| size | 10mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 93.20 Pln | |
| Chemat | 50mg | 98.00 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 630.80 Pln | |
| Chemat | 5mg | 83.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ala-Leu is a dipeptide formed from L-alanyl and L-leucine residues. It has a role as a metabolite. It is a tautomer of an Ala-Leu zwitterion.
Source: ChEBI
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid |
| InChIKey | RDIKFPRVLJLMER-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)N |
Computed by PubChem (NCBI)