CAS 315700-65-3 appears in our catalog under these names: D–allo–Isoleucine Ethyl Ester Hydrochloride, D-allo-Isoleucine Ethyl Ester Hydrochloride, 97%, 97%, D-allo-Isoleucine Ethyl Ester Hydrochloride, 97%, H-D-Allo-Ile-OEt·HCl, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
Ethyl (2R,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 315700-65-3) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: ethyl (2R,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: QQGRWNMNWONMOO-UOERWJHTSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | ethyl (2R,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | QQGRWNMNWONMOO-UOERWJHTSA-N |
| SMILES | CC[C@H](C)[C@H](C(=O)OCC)N.Cl |
Computed by PubChem (NCBI)