CAS 233772-41-3 is the registry number for Ethyl (2S,3R)-2-amino-3-methylpentanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl (2S,3R)-2-amino-3-methylpentanoate;hydrochloride (CAS 233772-41-3) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: ethyl (2S,3R)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: QQGRWNMNWONMOO-HHQFNNIRSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | ethyl (2S,3R)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | QQGRWNMNWONMOO-HHQFNNIRSA-N |
| SMILES | CC[C@@H](C)[C@@H](C(=O)OCC)N.Cl |
Computed by PubChem (NCBI)