CAS 135904-71-1 appears in our catalog under these names: H–D–Asp(OtBu)–OtBu·HCl, H-D-Asp(OtBu)-OtBu*HCl, D-Aspartic acid, bis(1,1-dimethylethyl) ester, hydrochloride, 95%, 95%, H-D-Asp(OtBu)-OtBu·HCl, 97.0%, (R)-DI-TERT-BUTYL 2-AMINOSUCCINATE HCL, 97%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 250mg, 1g, 5 g, 100 g.
Ditert-butyl (2R)-2-aminobutanedioate;hydrochloride (CAS 135904-71-1) is a chemical compound with the molecular formula C12H24ClNO4 and a molecular weight of 281.77 g/mol. IUPAC name: ditert-butyl (2R)-2-aminobutanedioate;hydrochloride. InChIKey: GVLZIMQSYQDAHB-DDWIOCJRSA-N.
| Molecular formula | C12H24ClNO4 |
|---|---|
| Molecular weight | 281.77 g/mol |
| IUPAC name | ditert-butyl (2R)-2-aminobutanedioate;hydrochloride |
| InChIKey | GVLZIMQSYQDAHB-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)