CAS 1334532-23-8 appears in our catalog under these names: O-Isovaleryl L-Carnitine Chloride- d9, Isovalerylcarnitine-d9 (chloride). Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 1 mg.
[(2R)-3-carboxy-2-(3-methylbutanoyloxy)propyl]-tris(trideuteriomethyl)azanium chloride (CAS 1334532-23-8) is a chemical compound with the molecular formula C12H24ClNO4 and a molecular weight of 290.83 g/mol. IUPAC name: [(2R)-3-carboxy-2-(3-methylbutanoyloxy)propyl]-tris(trideuteriomethyl)azanium chloride. InChIKey: HWDFIOSIRGUUSM-UGYZPRMBSA-N.
| Molecular formula | C12H24ClNO4 |
|---|---|
| Molecular weight | 290.83 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-(3-methylbutanoyloxy)propyl]-tris(trideuteriomethyl)azanium chloride |
| InChIKey | HWDFIOSIRGUUSM-UGYZPRMBSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C[C@@H](CC(=O)O)OC(=O)CC(C)C)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)