CAS 1791-13-5 appears in our catalog under these names: H–Asp(OtBu)–OtBu·HCl, H-Asp(OtBu)-OtBu HCl/ 99.96% (existing batch purity), H-L-Asp(OtBu)-OtBu*HCl, L-Aspartic acid di-tert-butyl ester hydrochloride, 98% , L-Aspartic acid di-tert-butyl ester HCl. Offered by: GLPBio, TargetMol, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100g, 1g, 5g, 25g, 50g, 10g, 500g, 1000g.
Ditert-butyl (2S)-2-aminobutanedioate;hydrochloride (CAS 1791-13-5) is a chemical compound with the molecular formula C12H24ClNO4 and a molecular weight of 281.77 g/mol. IUPAC name: ditert-butyl (2S)-2-aminobutanedioate;hydrochloride. InChIKey: GVLZIMQSYQDAHB-QRPNPIFTSA-N.
| Molecular formula | C12H24ClNO4 |
|---|---|
| Molecular weight | 281.77 g/mol |
| IUPAC name | ditert-butyl (2S)-2-aminobutanedioate;hydrochloride |
| InChIKey | GVLZIMQSYQDAHB-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)