Products 162040-64-4
CAS 162040-64-4 appears in our catalog under these names: Valeryl-L-Carnitine Chloride, Valeryl-L-carnitine Chloride, >95% (HPLC), Valeryl-L-carnitine (chloride), Valeryl–L–carnitine (chloride), C5:0 L-CARNITINE (HCL SALT). Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 25mg, 5mg, 10mg, 50mg, 5 mg, 10 mg.
[(2R)-3-carboxy-2-pentanoyloxypropyl]-trimethylazanium chloride (CAS 162040-64-4) is a chemical compound with the molecular formula C12H24ClNO4 and a molecular weight of 281.77 g/mol. IUPAC name: [(2R)-3-carboxy-2-pentanoyloxypropyl]-trimethylazanium chloride. InChIKey: REFPVMRTHIMPLJ-HNCPQSOCSA-N.
| Molecular formula | C12H24ClNO4 |
|---|---|
| Molecular weight | 281.77 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-pentanoyloxypropyl]-trimethylazanium chloride |
| InChIKey | REFPVMRTHIMPLJ-HNCPQSOCSA-N |
| SMILES | CCCCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)