Products 2608872-54-2
CAS 2608872-54-2 appears in our catalog under these names: 3-Methylbutyryl-DL-carnitine-d9 HCl (N,N,N-trimethyl-d9), 99 atom % D, min 98% Chemical Purity, Isovaleryl–DL–carnitine–d9 (chloride), Isovaleryl-DL-carnitine-d9 (chloride), 99%, 99%, 3-Methylbutyryl-DL-carnitine-d9 (hydrochloride), 99.72%. Offered by: CDN, GLPBio, Chemat, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 1mg, 5mg, 5 mg, 1 mg.
[3-carboxy-2-(3-methylbutanoyloxy)propyl]-tris(trideuteriomethyl)azanium chloride (CAS 2608872-54-2) is a chemical compound with the molecular formula C12H24ClNO4 and a molecular weight of 290.83 g/mol. IUPAC name: [3-carboxy-2-(3-methylbutanoyloxy)propyl]-tris(trideuteriomethyl)azanium chloride. InChIKey: HWDFIOSIRGUUSM-WTUXFOGGSA-N.
| Molecular formula | C12H24ClNO4 |
|---|---|
| Molecular weight | 290.83 g/mol |
| IUPAC name | [3-carboxy-2-(3-methylbutanoyloxy)propyl]-tris(trideuteriomethyl)azanium chloride |
| InChIKey | HWDFIOSIRGUUSM-WTUXFOGGSA-N |
| SMILES | [2H]C([2H])([2H])[N+](CC(CC(=O)O)OC(=O)CC(C)C)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)