cas: 93299-40-2 — see every product listed under this CAS number, including other names
H-D-Trp(5-Br)-OH 95% (CAS 93299-40-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A993287-250mg |
| cas | 93299-40-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1265.94 Pln | |
| Ambeed | 10g | 1861.13 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A993287 |
(2R)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid (CAS 93299-40-2) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: (2R)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid. InChIKey: KZDNJQUJBMDHJW-SECBINFHSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | (2R)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | KZDNJQUJBMDHJW-SECBINFHSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)