CAS 93299-40-2 appears in our catalog under these names: (R)-2-Amino-3-(5-bromo-1h-indol-3-yl)propanoic acid, 95%, D–5–Bromotryptophan, (R)-2-Amino-3-(5-bromo-1H-indol-3-yl)propanoic acid, 95%, 95%, H-D-Trp(5-Br)-OH, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
(2R)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid (CAS 93299-40-2) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: (2R)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid. InChIKey: KZDNJQUJBMDHJW-SECBINFHSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | (2R)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | KZDNJQUJBMDHJW-SECBINFHSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)