CAS 79422-73-4 appears in our catalog under these names: 2–Amino–2–(3–bromophenyl)acetic acid, 2-Amino-2-(3-bromophenyl)acetic acid, 95%, 95%, 2-Amino-2-(3-bromophenyl)acetic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 25g, 5g, 100g.
2-amino-2-(3-bromophenyl)acetic acid (CAS 79422-73-4) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-amino-2-(3-bromophenyl)acetic acid. InChIKey: MJPMYLPJAVQUQA-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-amino-2-(3-bromophenyl)acetic acid |
| InChIKey | MJPMYLPJAVQUQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(=O)O)N |
Computed by PubChem (NCBI)