CAS 2166163-71-7 appears in our catalog under these names: (R)-2-Amino-2-(3-bromophenyl)acetic acid, 97%, (R)-2-Amino-2-(3-bromophenyl)acetic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 250mg, 500mg.
(2R)-2-amino-2-(3-bromophenyl)acetic acid (CAS 2166163-71-7) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: (2R)-2-amino-2-(3-bromophenyl)acetic acid. InChIKey: MJPMYLPJAVQUQA-SSDOTTSWSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-bromophenyl)acetic acid |
| InChIKey | MJPMYLPJAVQUQA-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)