CAS 2088419-03-6 appears in our catalog under these names: (S)-2-Amino-2-(3-bromophenyl)acetic acid, 95%, (S)-2-Amino-2-(3-bromophenyl)acetic acid, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
(2S)-2-amino-2-(3-bromophenyl)acetic acid (CAS 2088419-03-6) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: (2S)-2-amino-2-(3-bromophenyl)acetic acid. InChIKey: MJPMYLPJAVQUQA-ZETCQYMHSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-bromophenyl)acetic acid |
| InChIKey | MJPMYLPJAVQUQA-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)