CAS 90580-64-6 appears in our catalog under these names: 4-Borono-D,L-phenylalanine, 98%, 2–Amino–3–(4–boronophenyl)propanoic acid, p-Boronophenylalanine, 97%, 97%, 2-Amino-3-(4-boronophenyl)propanoic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-amino-3-(4-boronophenyl)propanoic acid (CAS 90580-64-6) is a chemical compound with the molecular formula C9H12BNO4 and a molecular weight of 209.01 g/mol. IUPAC name: 2-amino-3-(4-boronophenyl)propanoic acid. InChIKey: NFIVJOSXJDORSP-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4 |
|---|---|
| Molecular weight | 209.01 g/mol |
| IUPAC name | 2-amino-3-(4-boronophenyl)propanoic acid |
| InChIKey | NFIVJOSXJDORSP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CC(C(=O)O)N)(O)O |
Computed by PubChem (NCBI)